C21H21ClN2O3 — CID 97274809
(4R)-1-[2-[3-(2-chlorophenoxy)azetidin-1-yl]-2-oxoethyl]-4-phenylpyrrolidin-2-one (PubChem CID 97274809) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is (4R)-1-[2-[3-(2-chlorophenoxy)azetidin-1-yl]-2-oxoethyl]-4-phenylpyrrolidin-2-one.
| Compound Name | (4R)-1-[2-[3-(2-chlorophenoxy)azetidin-1-yl]-2-oxoethyl]-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 97274809 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (4R)-1-[2-[3-(2-chlorophenoxy)azetidin-1-yl]-2-oxoethyl]-4-phenylpyrrolidin-2-one |
| SMILES | O=C(CN1C[C@@H](c2ccccc2)CC1=O)N1CC(Oc2ccccc2Cl)C1 |
| InChI | InChI=1S/C21H21ClN2O3/c22-18-8-4-5-9-19(18)27-17-12-24(13-17)21(26)14-23-11-16(10-20(23)25)15-6-2-1-3-7-15/h1-9,16-17H,10-14H2/t16-/m0/s1 |
| InChIKey | WNZSOBNYKDKWAR-INIZCTEOSA-N |
| XLogP | 2.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |