C18H23ClN2O3 — CID 70756717
1-[3-[3-(2-chlorophenoxy)azetidin-1-yl]-3-oxopropyl]azepan-2-one (PubChem CID 70756717) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-[3-[3-(2-chlorophenoxy)azetidin-1-yl]-3-oxopropyl]azepan-2-one.
| Compound Name | 1-[3-[3-(2-chlorophenoxy)azetidin-1-yl]-3-oxopropyl]azepan-2-one |
|---|---|
| PubChem CID | 70756717 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[3-[3-(2-chlorophenoxy)azetidin-1-yl]-3-oxopropyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCC(=O)N1CC(Oc2ccccc2Cl)C1 |
| InChI | InChI=1S/C18H23ClN2O3/c19-15-6-3-4-7-16(15)24-14-12-21(13-14)18(23)9-11-20-10-5-1-2-8-17(20)22/h3-4,6-7,14H,1-2,5,8-13H2 |
| InChIKey | HSKVYVIHHGFRTE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |