C31H30N4O5 — CID 45173908
2-(1,3-benzodioxol-5-yl)-4-[3-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione (PubChem CID 45173908) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-[3-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-[3-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45173908 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-[3-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C(C1CCCN(c2cccc3c2C(=O)N(c2ccc4c(c2)OCO4)C3=O)C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C31H30N4O5/c36-29(33-16-14-32(15-17-33)22-7-2-1-3-8-22)21-6-5-13-34(19-21)25-10-4-9-24-28(25)31(38)35(30(24)37)23-11-12-26-27(18-23)40-20-39-26/h1-4,7-12,18,21H,5-6,13-17,19-20H2 |
| InChIKey | UUOOGLSRWZCRST-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|