C31H37FN4O4 — CID 45173383
2-(2,2-dimethyloxan-4-yl)-4-[3-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione (PubChem CID 45173383) has the molecular formula C31H37FN4O4 and a molecular weight of 548.66 g/mol. Its IUPAC name is 2-(2,2-dimethyloxan-4-yl)-4-[3-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,2-dimethyloxan-4-yl)-4-[3-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45173383 |
| Molecular Formula | C31H37FN4O4 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | 2-(2,2-dimethyloxan-4-yl)-4-[3-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
| SMILES | CC1(C)CC(N2C(=O)c3cccc(N4CCCC(C(=O)N5CCN(c6ccccc6F)CC5)C4)c3C2=O)CCO1 |
| InChI | InChI=1S/C31H37FN4O4/c1-31(2)19-22(12-18-40-31)36-29(38)23-8-5-11-26(27(23)30(36)39)35-13-6-7-21(20-35)28(37)34-16-14-33(15-17-34)25-10-4-3-9-24(25)32/h3-5,8-11,21-22H,6-7,12-20H2,1-2H3 |
| InChIKey | NYDSODZWARAOGE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|