C28H31N3O5 — CID 26280763
(3S)-1-[2-(3,4-dimethoxyphenyl)-1,3-dioxoisoindol-4-yl]-N,N-bis(prop-2-enyl)piperidine-3-carboxamide (PubChem CID 26280763) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is (3S)-1-[2-(3,4-dimethoxyphenyl)-1,3-dioxoisoindol-4-yl]-N,N-bis(prop-2-enyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(3,4-dimethoxyphenyl)-1,3-dioxoisoindol-4-yl]-N,N-bis(prop-2-enyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26280763 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (3S)-1-[2-(3,4-dimethoxyphenyl)-1,3-dioxoisoindol-4-yl]-N,N-bis(prop-2-enyl)piperidine-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)[C@H]1CCCN(c2cccc3c2C(=O)N(c2ccc(OC)c(OC)c2)C3=O)C1 |
| InChI | InChI=1S/C28H31N3O5/c1-5-14-29(15-6-2)26(32)19-9-8-16-30(18-19)22-11-7-10-21-25(22)28(34)31(27(21)33)20-12-13-23(35-3)24(17-20)36-4/h5-7,10-13,17,19H,1-2,8-9,14-16,18H2,3-4H3/t19-/m0/s1 |
| InChIKey | BZRCILPXZNOUTF-IBGZPJMESA-N |
| XLogP | 3.92 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|