C20H23N3O3 — CID 42424487
(3R)-1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 42424487) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3R)-1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42424487 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (3R)-1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@@H]1CCCN(c2cccc3c2C(=O)N(C2CC2)C3=O)C1 |
| InChI | InChI=1S/C20H23N3O3/c1-2-10-21-18(24)13-5-4-11-22(12-13)16-7-3-6-15-17(16)20(26)23(19(15)25)14-8-9-14/h2-3,6-7,13-14H,1,4-5,8-12H2,(H,21,24)/t13-/m1/s1 |
| InChIKey | RKAUYJWJXFVJKN-CYBMUJFWSA-N |
| XLogP | 1.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|