C26H35N3O4 — CID 42372193
2-cycloheptyl-4-[4-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione (PubChem CID 42372193) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 2-cycloheptyl-4-[4-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-cycloheptyl-4-[4-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42372193 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 2-cycloheptyl-4-[4-[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCC(C(=O)N4CCC[C@H]4CO)CC3)c2C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C26H35N3O4/c30-17-20-9-6-14-28(20)24(31)18-12-15-27(16-13-18)22-11-5-10-21-23(22)26(33)29(25(21)32)19-7-3-1-2-4-8-19/h5,10-11,18-20,30H,1-4,6-9,12-17H2/t20-/m0/s1 |
| InChIKey | XPORHOSLSAQTRK-FQEVSTJZSA-N |
| XLogP | 3.21 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|