C23H24N4O3 — CID 42246773
1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 42246773) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42246773 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCN(c2cccc3c2C(=O)N(C2CC2)C3=O)CC1 |
| InChI | InChI=1S/C23H24N4O3/c28-21(25-14-15-3-2-10-24-13-15)16-8-11-26(12-9-16)19-5-1-4-18-20(19)23(30)27(22(18)29)17-6-7-17/h1-5,10,13,16-17H,6-9,11-12,14H2,(H,25,28) |
| InChIKey | MZFJDEOHPUZYIJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|