C29H39N3O5 — CID 42166229
ethyl 1-[1-[2-(cyclohexylmethyl)-1,3-dioxoisoindol-4-yl]piperidine-4-carbonyl]piperidine-4-carboxylate (PubChem CID 42166229) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is ethyl 1-[1-[2-(cyclohexylmethyl)-1,3-dioxoisoindol-4-yl]piperidine-4-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-[2-(cyclohexylmethyl)-1,3-dioxoisoindol-4-yl]piperidine-4-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42166229 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | ethyl 1-[1-[2-(cyclohexylmethyl)-1,3-dioxoisoindol-4-yl]piperidine-4-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CCN(c3cccc4c3C(=O)N(CC3CCCCC3)C4=O)CC2)CC1 |
| InChI | InChI=1S/C29H39N3O5/c1-2-37-29(36)22-13-17-31(18-14-22)26(33)21-11-15-30(16-12-21)24-10-6-9-23-25(24)28(35)32(27(23)34)19-20-7-4-3-5-8-20/h6,9-10,20-22H,2-5,7-8,11-19H2,1H3 |
| InChIKey | XHFQVEXMZVSBTQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|