C27H31FN2O5 — CID 145070137
2-[7-[[5-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial (PubChem CID 145070137) has the molecular formula C27H31FN2O5 and a molecular weight of 482.55 g/mol. Its IUPAC name is 2-[7-[[5-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial.
| Compound Name | 2-[7-[[5-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial |
|---|---|
| PubChem CID | 145070137 |
| Molecular Formula | C27H31FN2O5 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-[7-[[5-[(2,6-dimethylmorpholin-4-yl)methyl]-2-fluorophenyl]methoxy]-3-oxo-1H-isoindol-2-yl]pentanedial |
| SMILES | CC1CN(Cc2ccc(F)c(COc3cccc4c3CN(C(C=O)CCC=O)C4=O)c2)CC(C)O1 |
| InChI | InChI=1S/C27H31FN2O5/c1-18-12-29(13-19(2)35-18)14-20-8-9-25(28)21(11-20)17-34-26-7-3-6-23-24(26)15-30(27(23)33)22(16-32)5-4-10-31/h3,6-11,16,18-19,22H,4-5,12-15,17H2,1-2H3 |
| InChIKey | DATYFFOBQKITDP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|