C26H30N4O6 — CID 166795127
2-[7-[(Z)-2-amino-3-[N-amino-4-[(3R)-oxolan-3-yl]oxyanilino]prop-2-enoxy]-3-oxo-1H-isoindol-2-yl]pentanedial (PubChem CID 166795127) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-[7-[(Z)-2-amino-3-[N-amino-4-[(3R)-oxolan-3-yl]oxyanilino]prop-2-enoxy]-3-oxo-1H-isoindol-2-yl]pentanedial.
| Compound Name | 2-[7-[(Z)-2-amino-3-[N-amino-4-[(3R)-oxolan-3-yl]oxyanilino]prop-2-enoxy]-3-oxo-1H-isoindol-2-yl]pentanedial |
|---|---|
| PubChem CID | 166795127 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-[7-[(Z)-2-amino-3-[N-amino-4-[(3R)-oxolan-3-yl]oxyanilino]prop-2-enoxy]-3-oxo-1H-isoindol-2-yl]pentanedial |
| SMILES | N/C(=C\N(N)c1ccc(O[C@@H]2CCOC2)cc1)COc1cccc2c1CN(C(C=O)CCC=O)C2=O |
| InChI | InChI=1S/C26H30N4O6/c27-18(13-30(28)19-6-8-21(9-7-19)36-22-10-12-34-17-22)16-35-25-5-1-4-23-24(25)14-29(26(23)33)20(15-32)3-2-11-31/h1,4-9,11,13,15,20,22H,2-3,10,12,14,16-17,27-28H2/b18-13-/t20?,22-/m1/s1 |
| InChIKey | KTQSSWVNYBZFCP-NPFBOGPSSA-N |
| XLogP | 1.92 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|