C26H26N4O6 — CID 146666422
3-[3-oxo-7-[[2-[4-[(3S)-oxolan-3-yl]oxyphenyl]-1H-diazet-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146666422) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is 3-[3-oxo-7-[[2-[4-[(3S)-oxolan-3-yl]oxyphenyl]-1H-diazet-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[2-[4-[(3S)-oxolan-3-yl]oxyphenyl]-1H-diazet-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146666422 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 3-[3-oxo-7-[[2-[4-[(3S)-oxolan-3-yl]oxyphenyl]-1H-diazet-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4cn(-c5ccc(O[C@H]6CCOC6)cc5)[nH]4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26N4O6/c31-24-9-8-22(25(32)27-24)29-13-21-20(26(29)33)2-1-3-23(21)35-14-16-12-30(28-16)17-4-6-18(7-5-17)36-19-10-11-34-15-19/h1-7,12,19,22,28H,8-11,13-15H2,(H,27,31,32)/t19-,22?/m0/s1 |
| InChIKey | FEYFJAAWPHTVIM-YDNXMHBPSA-N |
| XLogP | 2.31 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|