C18H23N3O3 — CID 171789094
N-ethenyl-N'-methyl-2-[3-oxo-7-(2-oxoethoxy)-1H-isoindol-2-yl]pentanimidamide (PubChem CID 171789094) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-ethenyl-N'-methyl-2-[3-oxo-7-(2-oxoethoxy)-1H-isoindol-2-yl]pentanimidamide.
| Compound Name | N-ethenyl-N'-methyl-2-[3-oxo-7-(2-oxoethoxy)-1H-isoindol-2-yl]pentanimidamide |
|---|---|
| PubChem CID | 171789094 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-ethenyl-N'-methyl-2-[3-oxo-7-(2-oxoethoxy)-1H-isoindol-2-yl]pentanimidamide |
| SMILES | C=CN/C(=N\C)C(CCC)N1Cc2c(OCC=O)cccc2C1=O |
| InChI | InChI=1S/C18H23N3O3/c1-4-7-15(17(19-3)20-5-2)21-12-14-13(18(21)23)8-6-9-16(14)24-11-10-22/h5-6,8-10,15H,2,4,7,11-12H2,1,3H3,(H,19,20) |
| InChIKey | RGXBYQZVCWXRSE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|