C25H34N2O4 — CID 142516207
2-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxohexanamide;ethane (PubChem CID 142516207) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxohexanamide;ethane.
| Compound Name | 2-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxohexanamide;ethane |
|---|---|
| PubChem CID | 142516207 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxohexanamide;ethane |
| SMILES | C=C(/C=C\C(=C)COc1cccc2c1CN(C(CCC(C)=O)C(N)=O)C2=O)CC.CC |
| InChI | InChI=1S/C23H28N2O4.C2H6/c1-5-15(2)9-10-16(3)14-29-21-8-6-7-18-19(21)13-25(23(18)28)20(22(24)27)12-11-17(4)26;1-2/h6-10,20H,2-3,5,11-14H2,1,4H3,(H2,24,27);1-2H3/b10-9-; |
| InChIKey | OXMGSFJAALOTJJ-KVVVOXFISA-N |
| XLogP | 4.35 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|