C24H23N3O5 — CID 67334661
methyl 5-amino-5-oxo-4-[3-oxo-7-(quinolin-2-ylmethoxy)-1H-isoindol-2-yl]pentanoate (PubChem CID 67334661) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl 5-amino-5-oxo-4-[3-oxo-7-(quinolin-2-ylmethoxy)-1H-isoindol-2-yl]pentanoate.
| Compound Name | methyl 5-amino-5-oxo-4-[3-oxo-7-(quinolin-2-ylmethoxy)-1H-isoindol-2-yl]pentanoate |
|---|---|
| PubChem CID | 67334661 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl 5-amino-5-oxo-4-[3-oxo-7-(quinolin-2-ylmethoxy)-1H-isoindol-2-yl]pentanoate |
| SMILES | COC(=O)CCC(C(N)=O)N1Cc2c(OCc3ccc4ccccc4n3)cccc2C1=O |
| InChI | InChI=1S/C24H23N3O5/c1-31-22(28)12-11-20(23(25)29)27-13-18-17(24(27)30)6-4-8-21(18)32-14-16-10-9-15-5-2-3-7-19(15)26-16/h2-10,20H,11-14H2,1H3,(H2,25,29) |
| InChIKey | DPCFTWXJNIVTMH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |