C20H20N2O4 — CID 170631434
methyl 5-amino-5-oxo-4-(3-oxo-6-phenyl-1H-isoindol-2-yl)pentanoate (PubChem CID 170631434) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 5-amino-5-oxo-4-(3-oxo-6-phenyl-1H-isoindol-2-yl)pentanoate.
| Compound Name | methyl 5-amino-5-oxo-4-(3-oxo-6-phenyl-1H-isoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 170631434 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl 5-amino-5-oxo-4-(3-oxo-6-phenyl-1H-isoindol-2-yl)pentanoate |
| SMILES | COC(=O)CCC(C(N)=O)N1Cc2cc(-c3ccccc3)ccc2C1=O |
| InChI | InChI=1S/C20H20N2O4/c1-26-18(23)10-9-17(19(21)24)22-12-15-11-14(7-8-16(15)20(22)25)13-5-3-2-4-6-13/h2-8,11,17H,9-10,12H2,1H3,(H2,21,24) |
| InChIKey | MFMLNAFMBHWCKY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |