C18H24N2O4 — CID 159945708
tert-butyl 5-amino-4-(6-methyl-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate (PubChem CID 159945708) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl 5-amino-4-(6-methyl-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate.
| Compound Name | tert-butyl 5-amino-4-(6-methyl-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
|---|---|
| PubChem CID | 159945708 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl 5-amino-4-(6-methyl-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
| SMILES | Cc1ccc2c(c1)CN(C(CCC(=O)OC(C)(C)C)C(N)=O)C2=O |
| InChI | InChI=1S/C18H24N2O4/c1-11-5-6-13-12(9-11)10-20(17(13)23)14(16(19)22)7-8-15(21)24-18(2,3)4/h5-6,9,14H,7-8,10H2,1-4H3,(H2,19,22) |
| InChIKey | TYNCQIZJJOGHFV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |