C30H40N2O10S — CID 146502271
tert-butyl 5-amino-4-[6-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate (PubChem CID 146502271) has the molecular formula C30H40N2O10S and a molecular weight of 620.72 g/mol. Its IUPAC name is tert-butyl 5-amino-4-[6-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate.
| Compound Name | tert-butyl 5-amino-4-[6-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 146502271 |
| Molecular Formula | C30H40N2O10S |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | tert-butyl 5-amino-4-[6-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOc2ccc3c(c2)CN(C(CCC(=O)OC(C)(C)C)C(N)=O)C3=O)cc1 |
| InChI | InChI=1S/C30H40N2O10S/c1-21-5-8-24(9-6-21)43(36,37)41-18-16-39-14-13-38-15-17-40-23-7-10-25-22(19-23)20-32(29(25)35)26(28(31)34)11-12-27(33)42-30(2,3)4/h5-10,19,26H,11-18,20H2,1-4H3,(H2,31,34) |
| InChIKey | YZIULPQURAZFMM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 160.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|