C22H31N3O4 — CID 174272915
tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-6-piperidin-1-yl-1H-isoindol-2-yl)pentanoate (PubChem CID 174272915) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-6-piperidin-1-yl-1H-isoindol-2-yl)pentanoate.
| Compound Name | tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-6-piperidin-1-yl-1H-isoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 174272915 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-6-piperidin-1-yl-1H-isoindol-2-yl)pentanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(N)=O)N1Cc2cc(N3CCCCC3)ccc2C1=O |
| InChI | InChI=1S/C22H31N3O4/c1-22(2,3)29-19(26)10-9-18(20(23)27)25-14-15-13-16(7-8-17(15)21(25)28)24-11-5-4-6-12-24/h7-8,13,18H,4-6,9-12,14H2,1-3H3,(H2,23,27)/t18-/m0/s1 |
| InChIKey | UHMVSFLYULJZHD-SFHVURJKSA-N |
| XLogP | 2.61 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |