C26H34N2O5 — CID 153367630
tert-butyl 5-amino-4-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate (PubChem CID 153367630) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is tert-butyl 5-amino-4-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate.
| Compound Name | tert-butyl 5-amino-4-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 153367630 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | tert-butyl 5-amino-4-[7-[(Z)-2,5-dimethylidenehept-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate |
| SMILES | C=C(/C=C\C(=C)COc1cccc2c1CN(C(CCC(=O)OC(C)(C)C)C(N)=O)C2=O)CC |
| InChI | InChI=1S/C26H34N2O5/c1-7-17(2)11-12-18(3)16-32-22-10-8-9-19-20(22)15-28(25(19)31)21(24(27)30)13-14-23(29)33-26(4,5)6/h8-12,21H,2-3,7,13-16H2,1,4-6H3,(H2,27,30)/b12-11- |
| InChIKey | BIADPFITCQTWOS-QXMHVHEDSA-N |
| XLogP | 4.08 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|