C16H21ClN2O4S — CID 153305154
tert-butyl (4S)-5-amino-4-[3-(chloromethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]-5-oxopentanoate (PubChem CID 153305154) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is tert-butyl (4S)-5-amino-4-[3-(chloromethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]-5-oxopentanoate.
| Compound Name | tert-butyl (4S)-5-amino-4-[3-(chloromethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 153305154 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | tert-butyl (4S)-5-amino-4-[3-(chloromethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(N)=O)N1Cc2c(csc2CCl)C1=O |
| InChI | InChI=1S/C16H21ClN2O4S/c1-16(2,3)23-13(20)5-4-11(14(18)21)19-7-9-10(15(19)22)8-24-12(9)6-17/h8,11H,4-7H2,1-3H3,(H2,18,21)/t11-/m0/s1 |
| InChIKey | JYWRQOZKWPHAKU-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|