C17H21IN2O4 — CID 164592171
tert-butyl (4S)-5-amino-4-(7-iodo-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate (PubChem CID 164592171) has the molecular formula C17H21IN2O4 and a molecular weight of 444.27 g/mol. Its IUPAC name is tert-butyl (4S)-5-amino-4-(7-iodo-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate.
| Compound Name | tert-butyl (4S)-5-amino-4-(7-iodo-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
|---|---|
| PubChem CID | 164592171 |
| Molecular Formula | C17H21IN2O4 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | tert-butyl (4S)-5-amino-4-(7-iodo-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(N)=O)N1Cc2c(I)cccc2C1=O |
| InChI | InChI=1S/C17H21IN2O4/c1-17(2,3)24-14(21)8-7-13(15(19)22)20-9-11-10(16(20)23)5-4-6-12(11)18/h4-6,13H,7-9H2,1-3H3,(H2,19,22)/t13-/m0/s1 |
| InChIKey | FHXPVMGYOXWHFC-ZDUSSCGKSA-N |
| XLogP | 2.22 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|