C20H26N2O5 — CID 134579368
tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-7-prop-2-enoxy-1H-isoindol-2-yl)pentanoate (PubChem CID 134579368) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-7-prop-2-enoxy-1H-isoindol-2-yl)pentanoate.
| Compound Name | tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-7-prop-2-enoxy-1H-isoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 134579368 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl (4S)-5-amino-5-oxo-4-(3-oxo-7-prop-2-enoxy-1H-isoindol-2-yl)pentanoate |
| SMILES | C=CCOc1cccc2c1CN([C@@H](CCC(=O)OC(C)(C)C)C(N)=O)C2=O |
| InChI | InChI=1S/C20H26N2O5/c1-5-11-26-16-8-6-7-13-14(16)12-22(19(13)25)15(18(21)24)9-10-17(23)27-20(2,3)4/h5-8,15H,1,9-12H2,2-4H3,(H2,21,24)/t15-/m0/s1 |
| InChIKey | GYFNOGGQVQGVNJ-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|