C36H37F3N4O5S — CID 169024352
tert-butyl (4S)-5-amino-4-[7-[[2,6-difluoro-4-[1-(2-fluoro-4-isocyanophenyl)piperidin-4-yl]sulfanylphenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate (PubChem CID 169024352) has the molecular formula C36H37F3N4O5S and a molecular weight of 694.78 g/mol. Its IUPAC name is tert-butyl (4S)-5-amino-4-[7-[[2,6-difluoro-4-[1-(2-fluoro-4-isocyanophenyl)piperidin-4-yl]sulfanylphenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate.
| Compound Name | tert-butyl (4S)-5-amino-4-[7-[[2,6-difluoro-4-[1-(2-fluoro-4-isocyanophenyl)piperidin-4-yl]sulfanylphenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 169024352 |
| Molecular Formula | C36H37F3N4O5S |
| Molecular Weight | 694.78 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | tert-butyl (4S)-5-amino-4-[7-[[2,6-difluoro-4-[1-(2-fluoro-4-isocyanophenyl)piperidin-4-yl]sulfanylphenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanoate |
| SMILES | [C-]#[N+]c1ccc(N2CCC(Sc3cc(F)c(COc4cccc5c4CN(C(CCC(=O)OC(C)(C)C)C(N)=O)C5=O)c(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C36H37F3N4O5S/c1-36(2,3)48-33(44)11-10-31(34(40)45)43-19-25-24(35(43)46)6-5-7-32(25)47-20-26-27(37)17-23(18-28(26)38)49-22-12-14-42(15-13-22)30-9-8-21(41-4)16-29(30)39/h5-9,16-18,22,31H,10-15,19-20H2,1-3H3,(H2,40,45) |
| InChIKey | JWQUAOBSFPTQPN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.78 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|