C35H48N2O5 — CID 118582977
3-[7-[[4-[(2,2,3,3,5,5,6,6-octamethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]heptane-2,6-dione (PubChem CID 118582977) has the molecular formula C35H48N2O5 and a molecular weight of 576.78 g/mol. Its IUPAC name is 3-[7-[[4-[(2,2,3,3,5,5,6,6-octamethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]heptane-2,6-dione.
| Compound Name | 3-[7-[[4-[(2,2,3,3,5,5,6,6-octamethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]heptane-2,6-dione |
|---|---|
| PubChem CID | 118582977 |
| Molecular Formula | C35H48N2O5 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | 3-[7-[[4-[(2,2,3,3,5,5,6,6-octamethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]heptane-2,6-dione |
| SMILES | CC(=O)CCC(C(C)=O)N1Cc2c(OCc3ccc(CN4C(C)(C)C(C)(C)OC(C)(C)C4(C)C)cc3)cccc2C1=O |
| InChI | InChI=1S/C35H48N2O5/c1-23(38)14-19-29(24(2)39)36-21-28-27(31(36)40)12-11-13-30(28)41-22-26-17-15-25(16-18-26)20-37-32(3,4)34(7,8)42-35(9,10)33(37,5)6/h11-13,15-18,29H,14,19-22H2,1-10H3 |
| InChIKey | KYSAQJXPZAQJEH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |