C25H31N5O3 — CID 166795143
4-[7-[(Z)-3-amino-4-(N-aminoanilino)but-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-(methylamino)hex-5-enal (PubChem CID 166795143) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 4-[7-[(Z)-3-amino-4-(N-aminoanilino)but-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-(methylamino)hex-5-enal.
| Compound Name | 4-[7-[(Z)-3-amino-4-(N-aminoanilino)but-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-(methylamino)hex-5-enal |
|---|---|
| PubChem CID | 166795143 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 4-[7-[(Z)-3-amino-4-(N-aminoanilino)but-3-enoxy]-3-oxo-1H-isoindol-2-yl]-5-(methylamino)hex-5-enal |
| SMILES | C=C(NC)C(CCC=O)N1Cc2c(OCC/C(N)=C/N(N)c3ccccc3)cccc2C1=O |
| InChI | InChI=1S/C25H31N5O3/c1-18(28-2)23(11-7-14-31)29-17-22-21(25(29)32)10-6-12-24(22)33-15-13-19(26)16-30(27)20-8-4-3-5-9-20/h3-6,8-10,12,14,16,23,28H,1,7,11,13,15,17,26-27H2,2H3/b19-16- |
| InChIKey | LKULHEVOSFKSSP-MNDPQUGUSA-N |
| XLogP | 2.67 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|