C25H33N5O3 — CID 166701558
1-[4-[[1-imino-2-[2-(methylamino)-6-oxohex-1-en-3-yl]-3H-isoindol-4-yl]oxy]butanoyl]piperidine-4-carbonitrile (PubChem CID 166701558) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-[4-[[1-imino-2-[2-(methylamino)-6-oxohex-1-en-3-yl]-3H-isoindol-4-yl]oxy]butanoyl]piperidine-4-carbonitrile.
| Compound Name | 1-[4-[[1-imino-2-[2-(methylamino)-6-oxohex-1-en-3-yl]-3H-isoindol-4-yl]oxy]butanoyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 166701558 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 1-[4-[[1-imino-2-[2-(methylamino)-6-oxohex-1-en-3-yl]-3H-isoindol-4-yl]oxy]butanoyl]piperidine-4-carbonitrile |
| SMILES | [H]/N=C1\c2cccc(OCCCC(=O)N3CCC(C#N)CC3)c2CN1C(CCC=O)C(=C)NC |
| InChI | InChI=1S/C25H33N5O3/c1-18(28-2)22(7-4-14-31)30-17-21-20(25(30)27)6-3-8-23(21)33-15-5-9-24(32)29-12-10-19(16-26)11-13-29/h3,6,8,14,19,22,27-28H,1,4-5,7,9-13,15,17H2,2H3/b27-25+ |
| InChIKey | QSIIPWOZLYYIMN-IMVLJIQESA-N |
| XLogP | 2.83 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|