C25H27N5O4 — CID 166794995
N-methyl-5-oxo-2-[3-oxo-7-[[1-[(1S)-1-phenylethyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]pentanamide (PubChem CID 166794995) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-methyl-5-oxo-2-[3-oxo-7-[[1-[(1S)-1-phenylethyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]pentanamide.
| Compound Name | N-methyl-5-oxo-2-[3-oxo-7-[[1-[(1S)-1-phenylethyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 166794995 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-methyl-5-oxo-2-[3-oxo-7-[[1-[(1S)-1-phenylethyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]pentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(OCc3cn([C@@H](C)c4ccccc4)nn3)cccc2C1=O |
| InChI | InChI=1S/C25H27N5O4/c1-17(18-8-4-3-5-9-18)30-14-19(27-28-30)16-34-23-12-6-10-20-21(23)15-29(25(20)33)22(11-7-13-31)24(32)26-2/h3-6,8-10,12-14,17,22H,7,11,15-16H2,1-2H3,(H,26,32)/t17-,22?/m0/s1 |
| InChIKey | SYWRJQOYEVAKDT-LBOXEOMUSA-N |
| XLogP | 2.52 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|