C22H24FN3O4 — CID 130389143
2-[7-[(2-fluoro-3-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 130389143) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-[7-[(2-fluoro-3-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[(2-fluoro-3-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 130389143 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-[7-[(2-fluoro-3-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(NCc3cccc(OC)c3F)cccc2C1=O |
| InChI | InChI=1S/C22H24FN3O4/c1-24-21(28)18(9-5-11-27)26-13-16-15(22(26)29)7-4-8-17(16)25-12-14-6-3-10-19(30-2)20(14)23/h3-4,6-8,10-11,18,25H,5,9,12-13H2,1-2H3,(H,24,28) |
| InChIKey | SXKDLQXZJRSBSD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|