C29H40N4O11 — CID 145282147
ethane;2-[7-[[4-[(2,2,3,3,5,5,6-heptahydroxy-6-methylmorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 145282147) has the molecular formula C29H40N4O11 and a molecular weight of 620.66 g/mol. Its IUPAC name is ethane;2-[7-[[4-[(2,2,3,3,5,5,6-heptahydroxy-6-methylmorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | ethane;2-[7-[[4-[(2,2,3,3,5,5,6-heptahydroxy-6-methylmorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 145282147 |
| Molecular Formula | C29H40N4O11 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | ethane;2-[7-[[4-[(2,2,3,3,5,5,6-heptahydroxy-6-methylmorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CC.CNC(=O)C(CCC=O)N1Cc2c(NCc3ccc(CN4C(O)(O)C(C)(O)OC(O)(O)C4(O)O)cc3)cccc2C1=O |
| InChI | InChI=1S/C27H34N4O11.C2H6/c1-24(35)25(36,37)31(26(38,39)27(40,41)42-24)14-17-10-8-16(9-11-17)13-29-20-6-3-5-18-19(20)15-30(23(18)34)21(7-4-12-32)22(33)28-2;1-2/h3,5-6,8-12,21,29,35-41H,4,7,13-15H2,1-2H3,(H,28,33);1-2H3 |
| InChIKey | QYJDRHDJNLZDTG-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 232.59 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|