C26H31FN4O16 — CID 145070197
2-[7-[[2-fluoro-4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxy-N-methyl-5-oxopentanamide (PubChem CID 145070197) has the molecular formula C26H31FN4O16 and a molecular weight of 674.54 g/mol. Its IUPAC name is 2-[7-[[2-fluoro-4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxy-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[[2-fluoro-4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxy-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 145070197 |
| Molecular Formula | C26H31FN4O16 |
| Molecular Weight | 674.54 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | 2-[7-[[2-fluoro-4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3,3,4,4-tetrahydroxy-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(N1Cc2c(NCc3ccc(CN4C(O)(O)C(O)(O)OC(O)(O)C4(O)O)cc3F)cccc2C1=O)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C26H31FN4O16/c1-28-19(33)18(22(37,38)21(35,36)11-32)30-10-15-14(20(30)34)3-2-4-17(15)29-8-13-6-5-12(7-16(13)27)9-31-23(39,40)25(43,44)47-26(45,46)24(31,41)42/h2-7,11,18,29,35-46H,8-10H2,1H3,(H,28,33) |
| InChIKey | BSHDUTWBZPWMMU-UHFFFAOYSA-N |
| XLogP | -6.55 |
| TPSA | 333.74 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.54 |
| LogP ≤ 5 | -6.55 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|