C29H39FN4O7 — CID 142374556
3-[7-[[4-[dihydroxy(morpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione;ethane (PubChem CID 142374556) has the molecular formula C29H39FN4O7 and a molecular weight of 574.65 g/mol. Its IUPAC name is 3-[7-[[4-[dihydroxy(morpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione;ethane.
| Compound Name | 3-[7-[[4-[dihydroxy(morpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 142374556 |
| Molecular Formula | C29H39FN4O7 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 3-[7-[[4-[dihydroxy(morpholin-4-yl)methyl]-2-fluorophenyl]methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione;ethane |
| SMILES | CC.CC.O=C1CCC(O)(N2Cc3c(NCc4ccc(C(O)(O)N5CCOCC5)cc4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27FN4O7.2C2H6/c26-19-12-16(25(35,36)29-8-10-37-11-9-29)5-4-15(19)13-27-20-3-1-2-17-18(20)14-30(22(17)32)24(34)7-6-21(31)28-23(24)33;2*1-2/h1-5,12,27,34-36H,6-11,13-14H2,(H,28,31,33);2*1-2H3 |
| InChIKey | BCBGFJXYVMGRQR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 151.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|