C29H39FN4O11 — CID 145070822
ethane;3-[7-[[2-fluoro-3,5,6-trihydroxy-4-(morpholin-4-ylmethyl)phenyl]methylamino]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione (PubChem CID 145070822) has the molecular formula C29H39FN4O11 and a molecular weight of 638.65 g/mol. Its IUPAC name is ethane;3-[7-[[2-fluoro-3,5,6-trihydroxy-4-(morpholin-4-ylmethyl)phenyl]methylamino]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione.
| Compound Name | ethane;3-[7-[[2-fluoro-3,5,6-trihydroxy-4-(morpholin-4-ylmethyl)phenyl]methylamino]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 145070822 |
| Molecular Formula | C29H39FN4O11 |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 638.26 |
| IUPAC Name | ethane;3-[7-[[2-fluoro-3,5,6-trihydroxy-4-(morpholin-4-ylmethyl)phenyl]methylamino]-4,5,6-trihydroxy-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
| SMILES | CC.CC.O=C1CCC(O)(N2Cc3c(NCc4c(O)c(O)c(CN5CCOCC5)c(O)c4F)c(O)c(O)c(O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27FN4O11.2C2H6/c26-15-10(18(33)19(34)12(17(15)32)8-29-3-5-41-6-4-29)7-27-16-11-9-30(25(40)2-1-13(31)28-24(25)39)23(38)14(11)20(35)22(37)21(16)36;2*1-2/h27,32-37,40H,1-9H2,(H,28,31,39);2*1-2H3 |
| InChIKey | WUBHRUDBOVJPPC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 232.59 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|