C21H20FN3O5 — CID 166797671
(3S)-3-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione (PubChem CID 166797671) has the molecular formula C21H20FN3O5 and a molecular weight of 413.41 g/mol. Its IUPAC name is (3S)-3-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione.
| Compound Name | (3S)-3-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 166797671 |
| Molecular Formula | C21H20FN3O5 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (3S)-3-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-3-hydroxypiperidine-2,6-dione |
| SMILES | COc1ccc(CNc2cccc3c2CN([C@]2(O)CCC(=O)NC2=O)C3=O)c(F)c1 |
| InChI | InChI=1S/C21H20FN3O5/c1-30-13-6-5-12(16(22)9-13)10-23-17-4-2-3-14-15(17)11-25(19(14)27)21(29)8-7-18(26)24-20(21)28/h2-6,9,23,29H,7-8,10-11H2,1H3,(H,24,26,28)/t21-/m0/s1 |
| InChIKey | LCQKTYMYOXHAPD-NRFANRHFSA-N |
| XLogP | 1.53 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|