C22H24FN3O5 — CID 145070633
2-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-2-hydroxy-N-methyl-5-oxopentanamide (PubChem CID 145070633) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is 2-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-2-hydroxy-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-2-hydroxy-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 145070633 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[7-[(2-fluoro-4-methoxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-2-hydroxy-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(O)(CCC=O)N1Cc2c(NCc3ccc(OC)cc3F)cccc2C1=O |
| InChI | InChI=1S/C22H24FN3O5/c1-24-21(29)22(30,9-4-10-27)26-13-17-16(20(26)28)5-3-6-19(17)25-12-14-7-8-15(31-2)11-18(14)23/h3,5-8,10-11,25,30H,4,9,12-13H2,1-2H3,(H,24,29) |
| InChIKey | DHONSWIFWQMQDU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|