C26H31N3O14 — CID 135292863
2-hydroxy-N-methyl-2-[7-[[4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide (PubChem CID 135292863) has the molecular formula C26H31N3O14 and a molecular weight of 609.54 g/mol. Its IUPAC name is 2-hydroxy-N-methyl-2-[7-[[4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide.
| Compound Name | 2-hydroxy-N-methyl-2-[7-[[4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 135292863 |
| Molecular Formula | C26H31N3O14 |
| Molecular Weight | 609.54 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 2-hydroxy-N-methyl-2-[7-[[4-[(2,2,3,3,5,5,6,6-octahydroxymorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
| SMILES | CNC(=O)C(O)(CCC=O)N1Cc2c(OCc3ccc(CN4C(O)(O)C(O)(O)OC(O)(O)C4(O)O)cc3)cccc2C1=O |
| InChI | InChI=1S/C26H31N3O14/c1-27-21(32)22(33,10-3-11-30)28-13-18-17(20(28)31)4-2-5-19(18)42-14-16-8-6-15(7-9-16)12-29-23(34,35)25(38,39)43-26(40,41)24(29,36)37/h2,4-9,11,33-41H,3,10,12-14H2,1H3,(H,27,32) |
| InChIKey | ZBABMVZGHMUPBO-UHFFFAOYSA-N |
| XLogP | -3.98 |
| TPSA | 270.25 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.54 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|