C28H34Cl2N4O4 — CID 166701589
(2S)-2-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-N,2-dimethyl-5-oxopentanamide (PubChem CID 166701589) has the molecular formula C28H34Cl2N4O4 and a molecular weight of 561.51 g/mol. Its IUPAC name is (2S)-2-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-N,2-dimethyl-5-oxopentanamide.
| Compound Name | (2S)-2-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-N,2-dimethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166701589 |
| Molecular Formula | C28H34Cl2N4O4 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (2S)-2-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-N,2-dimethyl-5-oxopentanamide |
| SMILES | CNC(=O)[C@](C)(CCC=O)N1Cc2c(OCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cccc2C1=O |
| InChI | InChI=1S/C28H34Cl2N4O4/c1-28(11-5-17-35,27(37)31-2)34-19-21-20(26(34)36)7-3-10-24(21)38-18-6-12-32-13-15-33(16-14-32)23-9-4-8-22(29)25(23)30/h3-4,7-10,17H,5-6,11-16,18-19H2,1-2H3,(H,31,37)/t28-/m0/s1 |
| InChIKey | RARWSBBGKUKBQW-NDEPHWFRSA-N |
| XLogP | 4.02 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|