C27H30Cl2N4O4 — CID 162769888
(3S)-3-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-3-methylpiperidine-2,6-dione (PubChem CID 162769888) has the molecular formula C27H30Cl2N4O4 and a molecular weight of 545.47 g/mol. Its IUPAC name is (3S)-3-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-3-methylpiperidine-2,6-dione.
| Compound Name | (3S)-3-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 162769888 |
| Molecular Formula | C27H30Cl2N4O4 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | (3S)-3-[7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3-oxo-1H-isoindol-2-yl]-3-methylpiperidine-2,6-dione |
| SMILES | C[C@]1(N2Cc3c(OCCCN4CCN(c5cccc(Cl)c5Cl)CC4)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C27H30Cl2N4O4/c1-27(10-9-23(34)30-26(27)36)33-17-19-18(25(33)35)5-2-8-22(19)37-16-4-11-31-12-14-32(15-13-31)21-7-3-6-20(28)24(21)29/h2-3,5-8H,4,9-17H2,1H3,(H,30,34,36)/t27-/m0/s1 |
| InChIKey | MDIVQYHRWBVDLS-MHZLTWQESA-N |
| XLogP | 3.74 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|