C30H31F3N4O5 — CID 146479975
1-[3-[[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]oxy]propyl]-4-[2-(trifluoromethoxy)phenyl]piperidine-4-carbonitrile (PubChem CID 146479975) has the molecular formula C30H31F3N4O5 and a molecular weight of 584.60 g/mol. Its IUPAC name is 1-[3-[[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]oxy]propyl]-4-[2-(trifluoromethoxy)phenyl]piperidine-4-carbonitrile.
| Compound Name | 1-[3-[[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]oxy]propyl]-4-[2-(trifluoromethoxy)phenyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 146479975 |
| Molecular Formula | C30H31F3N4O5 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 1-[3-[[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]oxy]propyl]-4-[2-(trifluoromethoxy)phenyl]piperidine-4-carbonitrile |
| SMILES | C[C@]1(N2Cc3c(OCCCN4CCC(C#N)(c5ccccc5OC(F)(F)F)CC4)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C30H31F3N4O5/c1-28(11-10-25(38)35-27(28)40)37-18-21-20(26(37)39)6-4-9-23(21)41-17-5-14-36-15-12-29(19-34,13-16-36)22-7-2-3-8-24(22)42-30(31,32)33/h2-4,6-9H,5,10-18H2,1H3,(H,35,38,40)/t28-/m0/s1 |
| InChIKey | XXUMXCDADGXNJB-NDEPHWFRSA-N |
| XLogP | 4.06 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|