C16H18N2O4 — CID 163267686
ethane;2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 163267686) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethane;2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | ethane;2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 163267686 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | ethane;2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC.CC1(N2C(=O)c3ccccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H12N2O4.C2H6/c1-14(7-6-10(17)15-13(14)20)16-11(18)8-4-2-3-5-9(8)12(16)19;1-2/h2-5H,6-7H2,1H3,(H,15,17,20);1-2H3 |
| InChIKey | OSVZXEPVVVYULW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|