C14H13N3O4 — CID 140915010
4-amino-2-[(3S)-2,6-dioxo-3-(trideuteriomethyl)piperidin-3-yl]isoindole-1,3-dione (PubChem CID 140915010) has the molecular formula C14H13N3O4 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-amino-2-[(3S)-2,6-dioxo-3-(trideuteriomethyl)piperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(3S)-2,6-dioxo-3-(trideuteriomethyl)piperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 140915010 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-amino-2-[(3S)-2,6-dioxo-3-(trideuteriomethyl)piperidin-3-yl]isoindole-1,3-dione |
| SMILES | [2H]C([2H])([2H])[C@]1(N2C(=O)c3cccc(N)c3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H13N3O4/c1-14(6-5-9(18)16-13(14)21)17-11(19)7-3-2-4-8(15)10(7)12(17)20/h2-4H,5-6,15H2,1H3,(H,16,18,21)/t14-/m0/s1/i1D3 |
| InChIKey | VZTDWPXKIYLLAT-FVELLDLOSA-N |
| XLogP | 0.06 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|