C20H17N3O4 — CID 166923781
4-amino-2-(3-benzyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166923781) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 4-amino-2-(3-benzyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-amino-2-(3-benzyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166923781 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-amino-2-(3-benzyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(C1(Cc3ccccc3)CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H17N3O4/c21-14-8-4-7-13-16(14)18(26)23(17(13)25)20(10-9-15(24)22-19(20)27)11-12-5-2-1-3-6-12/h1-8H,9-11,21H2,(H,22,24,27) |
| InChIKey | GWLRWURDRMDBHS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|