C23H18N4O5 — CID 166923902
2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxy-5-(1H-pyrazol-4-yl)isoindole-1,3-dione (PubChem CID 166923902) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxy-5-(1H-pyrazol-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxy-5-(1H-pyrazol-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166923902 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxy-5-(1H-pyrazol-4-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(Cc2ccccc2)(N2C(=O)c3ccc(-c4cn[nH]c4)c(O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18N4O5/c28-17-8-9-23(22(32)26-17,10-13-4-2-1-3-5-13)27-20(30)16-7-6-15(14-11-24-25-12-14)19(29)18(16)21(27)31/h1-7,11-12,29H,8-10H2,(H,24,25)(H,26,28,32) |
| InChIKey | CBQSDAQZHQYGFF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|