C18H18N4O6 — CID 58572144
N-[[3-(4-acetamido-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]acetamide (PubChem CID 58572144) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is N-[[3-(4-acetamido-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]acetamide.
| Compound Name | N-[[3-(4-acetamido-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 58572144 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[[3-(4-acetamido-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1(N2C(=O)c3cccc(NC(C)=O)c3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C18H18N4O6/c1-9(23)19-8-18(7-6-13(25)21-17(18)28)22-15(26)11-4-3-5-12(20-10(2)24)14(11)16(22)27/h3-5H,6-8H2,1-2H3,(H,19,23)(H,20,24)(H,21,25,28) |
| InChIKey | AWKNGQJZFRRSRZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|