C16H15N3O6 — CID 91166963
N-[2-(6-hydroxy-3-methyl-2,5-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 91166963) has the molecular formula C16H15N3O6 and a molecular weight of 345.31 g/mol. Its IUPAC name is N-[2-(6-hydroxy-3-methyl-2,5-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | N-[2-(6-hydroxy-3-methyl-2,5-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 91166963 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[2-(6-hydroxy-3-methyl-2,5-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)N(C1(C)CC(=O)C(O)NC1=O)C2=O |
| InChI | InChI=1S/C16H15N3O6/c1-7(20)17-9-5-3-4-8-11(9)14(24)19(13(8)23)16(2)6-10(21)12(22)18-15(16)25/h3-5,12,22H,6H2,1-2H3,(H,17,20)(H,18,25) |
| InChIKey | LICNBDMFYUNHSF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|