C12H13NO4 — CID 143956506
N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;ethane (PubChem CID 143956506) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;ethane.
| Compound Name | N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;ethane |
|---|---|
| PubChem CID | 143956506 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;ethane |
| SMILES | CC.CC(=O)Nc1cccc2c1C(=O)OC2=O |
| InChI | InChI=1S/C10H7NO4.C2H6/c1-5(12)11-7-4-2-3-6-8(7)10(14)15-9(6)13;1-2/h2-4H,1H3,(H,11,12);1-2H3 |
| InChIKey | BYTOTBRAWJFDPA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|