C13H10BrNO3 — CID 70291421
N-(6-bromo-7-methyl-5,8-dioxonaphthalen-1-yl)acetamide (PubChem CID 70291421) has the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. Its IUPAC name is N-(6-bromo-7-methyl-5,8-dioxonaphthalen-1-yl)acetamide.
| Compound Name | N-(6-bromo-7-methyl-5,8-dioxonaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 70291421 |
| Molecular Formula | C13H10BrNO3 |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | N-(6-bromo-7-methyl-5,8-dioxonaphthalen-1-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)C(C)=C(Br)C2=O |
| InChI | InChI=1S/C13H10BrNO3/c1-6-11(14)13(18)8-4-3-5-9(15-7(2)16)10(8)12(6)17/h3-5H,1-2H3,(H,15,16) |
| InChIKey | ZFJMROFTZCACIG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|