C16H11BrN2NaO6S — CID 131862171
CID 131862171 (PubChem CID 131862171) has the molecular formula C16H11BrN2NaO6S and a molecular weight of 462.23 g/mol.
| Compound Name | CID 131862171 |
|---|---|
| PubChem CID | 131862171 |
| Molecular Formula | C16H11BrN2NaO6S |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 460.94 |
| IUPAC Name | — |
| SMILES | CC(=O)Nc1cccc2c1C(=O)c1c(Br)cc(S(=O)(=O)O)c(N)c1C2=O.[Na] |
| InChI | InChI=1S/C16H11BrN2O6S.Na/c1-6(20)19-9-4-2-3-7-11(9)16(22)12-8(17)5-10(26(23,24)25)14(18)13(12)15(7)21;/h2-5H,18H2,1H3,(H,19,20)(H,23,24,25); |
| InChIKey | KFHFRCLBZKFYDN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|