C14H7BrClNO5S — CID 20541096
1-amino-4-bromo-7-chloro-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 20541096) has the molecular formula C14H7BrClNO5S and a molecular weight of 416.64 g/mol. Its IUPAC name is 1-amino-4-bromo-7-chloro-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-bromo-7-chloro-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 20541096 |
| Molecular Formula | C14H7BrClNO5S |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 414.89 |
| IUPAC Name | 1-amino-4-bromo-7-chloro-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Br)c2c1C(=O)c1cc(Cl)ccc1C2=O |
| InChI | InChI=1S/C14H7BrClNO5S/c15-8-4-9(23(20,21)22)12(17)11-10(8)13(18)6-2-1-5(16)3-7(6)14(11)19/h1-4H,17H2,(H,20,21,22) |
| InChIKey | YEWQHDWZAAMSGU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|