C16H7ClN4O2 — CID 159694004
1,4-diamino-6-chloro-9,10-dioxoanthracene-2,3-dicarbonitrile (PubChem CID 159694004) has the molecular formula C16H7ClN4O2 and a molecular weight of 322.71 g/mol. Its IUPAC name is 1,4-diamino-6-chloro-9,10-dioxoanthracene-2,3-dicarbonitrile.
| Compound Name | 1,4-diamino-6-chloro-9,10-dioxoanthracene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 159694004 |
| Molecular Formula | C16H7ClN4O2 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1,4-diamino-6-chloro-9,10-dioxoanthracene-2,3-dicarbonitrile |
| SMILES | N#Cc1c(N)c2c(c(N)c1C#N)C(=O)c1cc(Cl)ccc1C2=O |
| InChI | InChI=1S/C16H7ClN4O2/c17-6-1-2-7-8(3-6)16(23)12-11(15(7)22)13(20)9(4-18)10(5-19)14(12)21/h1-3H,20-21H2 |
| InChIKey | MWTRLEHTPQYRLF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|